C10H14FNO2 — CID 176776404
(2'R,6R,8S)-2'-fluoro-8-(hydroxymethyl)spiro[1,2,5,7-tetrahydropyrrolizine-6,1'-cyclopropane]-3-one (PubChem CID 176776404) has the molecular formula C10H14FNO2 and a molecular weight of 199.22 g/mol. Its IUPAC name is (2'R,6R,8S)-2'-fluoro-8-(hydroxymethyl)spiro[1,2,5,7-tetrahydropyrrolizine-6,1'-cyclopropane]-3-one.
| Compound Name | (2'R,6R,8S)-2'-fluoro-8-(hydroxymethyl)spiro[1,2,5,7-tetrahydropyrrolizine-6,1'-cyclopropane]-3-one |
|---|---|
| PubChem CID | 176776404 |
| Molecular Formula | C10H14FNO2 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | (2'R,6R,8S)-2'-fluoro-8-(hydroxymethyl)spiro[1,2,5,7-tetrahydropyrrolizine-6,1'-cyclopropane]-3-one |
| SMILES | O=C1CC[C@@]2(CO)C[C@@]3(C[C@H]3F)CN12 |
| InChI | InChI=1S/C10H14FNO2/c11-7-3-9(7)4-10(6-13)2-1-8(14)12(10)5-9/h7,13H,1-6H2/t7-,9+,10+/m1/s1 |
| InChIKey | OTTJZMXAOHCEED-JEZHCXPESA-N |
| XLogP | 0.47 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |