C13H21F2N — CID 176776468
(6S,8R)-3,3-dideuterio-8-(1,1-dideuterio-2-methylpropyl)-1',1'-difluorospiro[1,2,5,7-tetrahydropyrrolizine-6,2'-cyclopropane] (PubChem CID 176776468) has the molecular formula C13H21F2N and a molecular weight of 233.34 g/mol. Its IUPAC name is (6S,8R)-3,3-dideuterio-8-(1,1-dideuterio-2-methylpropyl)-1',1'-difluorospiro[1,2,5,7-tetrahydropyrrolizine-6,2'-cyclopropane].
| Compound Name | (6S,8R)-3,3-dideuterio-8-(1,1-dideuterio-2-methylpropyl)-1',1'-difluorospiro[1,2,5,7-tetrahydropyrrolizine-6,2'-cyclopropane] |
|---|---|
| PubChem CID | 176776468 |
| Molecular Formula | C13H21F2N |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | (6S,8R)-3,3-dideuterio-8-(1,1-dideuterio-2-methylpropyl)-1',1'-difluorospiro[1,2,5,7-tetrahydropyrrolizine-6,2'-cyclopropane] |
| SMILES | [2H]C1([2H])CC[C@@]2(C([2H])([2H])C(C)C)C[C@@]3(CN12)CC3(F)F |
| InChI | InChI=1S/C13H21F2N/c1-10(2)6-12-4-3-5-16(12)9-11(7-12)8-13(11,14)15/h10H,3-9H2,1-2H3/t11-,12+/m0/s1/i5D2,6D2 |
| InChIKey | VJFDVVIXPNKRDL-CCVHORCTSA-N |
| XLogP | 3.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |