C13H22FN — CID 176776511
(2'S,6S,8R)-3,3-dideuterio-8-(1,1-dideuterio-2-methylpropyl)-2'-fluorospiro[1,2,5,7-tetrahydropyrrolizine-6,1'-cyclopropane] (PubChem CID 176776511) has the molecular formula C13H22FN and a molecular weight of 215.35 g/mol. Its IUPAC name is (2'S,6S,8R)-3,3-dideuterio-8-(1,1-dideuterio-2-methylpropyl)-2'-fluorospiro[1,2,5,7-tetrahydropyrrolizine-6,1'-cyclopropane].
| Compound Name | (2'S,6S,8R)-3,3-dideuterio-8-(1,1-dideuterio-2-methylpropyl)-2'-fluorospiro[1,2,5,7-tetrahydropyrrolizine-6,1'-cyclopropane] |
|---|---|
| PubChem CID | 176776511 |
| Molecular Formula | C13H22FN |
| Molecular Weight | 215.35 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | (2'S,6S,8R)-3,3-dideuterio-8-(1,1-dideuterio-2-methylpropyl)-2'-fluorospiro[1,2,5,7-tetrahydropyrrolizine-6,1'-cyclopropane] |
| SMILES | [2H]C1([2H])CC[C@@]2(C([2H])([2H])C(C)C)C[C@]3(C[C@@H]3F)CN12 |
| InChI | InChI=1S/C13H22FN/c1-10(2)6-13-4-3-5-15(13)9-12(8-13)7-11(12)14/h10-11H,3-9H2,1-2H3/t11-,12+,13+/m0/s1/i5D2,6D2 |
| InChIKey | NJJVZUUEJUTDMG-ZNNYIWHPSA-N |
| XLogP | 3.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |