C11H18FN — CID 176776724
(2R,8S)-2-fluoro-6-methyl-8-propan-2-yl-1,2,3,5-tetrahydropyrrolizine (PubChem CID 176776724) has the molecular formula C11H18FN and a molecular weight of 183.27 g/mol. Its IUPAC name is (2R,8S)-2-fluoro-6-methyl-8-propan-2-yl-1,2,3,5-tetrahydropyrrolizine.
| Compound Name | (2R,8S)-2-fluoro-6-methyl-8-propan-2-yl-1,2,3,5-tetrahydropyrrolizine |
|---|---|
| PubChem CID | 176776724 |
| Molecular Formula | C11H18FN |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | (2R,8S)-2-fluoro-6-methyl-8-propan-2-yl-1,2,3,5-tetrahydropyrrolizine |
| SMILES | CC1=C[C@@]2(C(C)C)C[C@@H](F)CN2C1 |
| InChI | InChI=1S/C11H18FN/c1-8(2)11-4-9(3)6-13(11)7-10(12)5-11/h4,8,10H,5-7H2,1-3H3/t10-,11+/m1/s1 |
| InChIKey | CFOSJJVPYCVGEH-MNOVXSKESA-N |
| XLogP | 2.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|