C49H31N5S2 — CID 176777174
2-(4,6-diphenyl-1,3,5-triazin-2-yl)-6-[4-[4-(4-phenyl-[1]benzothiolo[3,2-d]pyrimidin-2-yl)phenyl]phenyl]benzenethiol (PubChem CID 176777174) has the molecular formula C49H31N5S2 and a molecular weight of 753.96 g/mol. Its IUPAC name is 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-6-[4-[4-(4-phenyl-[1]benzothiolo[3,2-d]pyrimidin-2-yl)phenyl]phenyl]benzenethiol.
| Compound Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-6-[4-[4-(4-phenyl-[1]benzothiolo[3,2-d]pyrimidin-2-yl)phenyl]phenyl]benzenethiol |
|---|---|
| PubChem CID | 176777174 |
| Molecular Formula | C49H31N5S2 |
| Molecular Weight | 753.96 g/mol |
| Exact Mass | 753.20 |
| IUPAC Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-6-[4-[4-(4-phenyl-[1]benzothiolo[3,2-d]pyrimidin-2-yl)phenyl]phenyl]benzenethiol |
| SMILES | Sc1c(-c2ccc(-c3ccc(-c4nc(-c5ccccc5)c5sc6ccccc6c5n4)cc3)cc2)cccc1-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C49H31N5S2/c55-44-38(20-12-21-40(44)49-53-47(35-15-6-2-7-16-35)52-48(54-49)36-17-8-3-9-18-36)33-27-23-31(24-28-33)32-25-29-37(30-26-32)46-50-42(34-13-4-1-5-14-34)45-43(51-46)39-19-10-11-22-41(39)56-45/h1-30,55H |
| InChIKey | WQWYJUJEBBNOKP-UHFFFAOYSA-N |
| XLogP | 12.99 |
| TPSA | 64.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.96 |
| LogP ≤ 5 | 12.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|