C13H19N7O10S — CID 176777213
2-[[4-[bis(carboxymethyl)amino]-6-[[(hydroxyamino)methylamino]methoxysulfanyl]-1,3,5-triazin-2-yl]-(carboxymethyl)amino]acetic acid (PubChem CID 176777213) has the molecular formula C13H19N7O10S and a molecular weight of 465.40 g/mol. Its IUPAC name is 2-[[4-[bis(carboxymethyl)amino]-6-[[(hydroxyamino)methylamino]methoxysulfanyl]-1,3,5-triazin-2-yl]-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[[4-[bis(carboxymethyl)amino]-6-[[(hydroxyamino)methylamino]methoxysulfanyl]-1,3,5-triazin-2-yl]-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 176777213 |
| Molecular Formula | C13H19N7O10S |
| Molecular Weight | 465.40 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | 2-[[4-[bis(carboxymethyl)amino]-6-[[(hydroxyamino)methylamino]methoxysulfanyl]-1,3,5-triazin-2-yl]-(carboxymethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)c1nc(SOCNCNO)nc(N(CC(=O)O)CC(=O)O)n1 |
| InChI | InChI=1S/C13H19N7O10S/c21-7(22)1-19(2-8(23)24)11-16-12(20(3-9(25)26)4-10(27)28)18-13(17-11)31-30-6-14-5-15-29/h14-15,29H,1-6H2,(H,21,22)(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | ZBRHECGOOFVQRL-UHFFFAOYSA-N |
| XLogP | -2.67 |
| TPSA | 247.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.40 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|