C25H20N2O4 — CID 176777302
2-[2-[[5-[3-(aminomethyl)phenyl]-1-benzofuran-3-yl]methoxy]-3-isocyanophenyl]acetic acid (PubChem CID 176777302) has the molecular formula C25H20N2O4 and a molecular weight of 412.45 g/mol. Its IUPAC name is 2-[2-[[5-[3-(aminomethyl)phenyl]-1-benzofuran-3-yl]methoxy]-3-isocyanophenyl]acetic acid.
| Compound Name | 2-[2-[[5-[3-(aminomethyl)phenyl]-1-benzofuran-3-yl]methoxy]-3-isocyanophenyl]acetic acid |
|---|---|
| PubChem CID | 176777302 |
| Molecular Formula | C25H20N2O4 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 2-[2-[[5-[3-(aminomethyl)phenyl]-1-benzofuran-3-yl]methoxy]-3-isocyanophenyl]acetic acid |
| SMILES | [C-]#[N+]c1cccc(CC(=O)O)c1OCc1coc2ccc(-c3cccc(CN)c3)cc12 |
| InChI | InChI=1S/C25H20N2O4/c1-27-22-7-3-6-19(12-24(28)29)25(22)31-15-20-14-30-23-9-8-18(11-21(20)23)17-5-2-4-16(10-17)13-26/h2-11,14H,12-13,15,26H2,(H,28,29) |
| InChIKey | NZCFQWNWVIVBTA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 90.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|