C38H22OS — CID 176777508
1,2,3,4,7,8,9,10-octadeuterio-6-dibenzothiophen-2-yl-11-naphthalen-2-ylnaphtho[2,3-b][1]benzofuran (PubChem CID 176777508) has the molecular formula C38H22OS and a molecular weight of 534.71 g/mol. Its IUPAC name is 1,2,3,4,7,8,9,10-octadeuterio-6-dibenzothiophen-2-yl-11-naphthalen-2-ylnaphtho[2,3-b][1]benzofuran.
| Compound Name | 1,2,3,4,7,8,9,10-octadeuterio-6-dibenzothiophen-2-yl-11-naphthalen-2-ylnaphtho[2,3-b][1]benzofuran |
|---|---|
| PubChem CID | 176777508 |
| Molecular Formula | C38H22OS |
| Molecular Weight | 534.71 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | 1,2,3,4,7,8,9,10-octadeuterio-6-dibenzothiophen-2-yl-11-naphthalen-2-ylnaphtho[2,3-b][1]benzofuran |
| SMILES | [2H]c1c([2H])c([2H])c2c(oc3c(-c4ccc5sc6ccccc6c5c4)c4c([2H])c([2H])c([2H])c([2H])c4c(-c4ccc5ccccc5c4)c32)c1[2H] |
| InChI | InChI=1S/C38H22OS/c1-2-10-24-21-25(18-17-23(24)9-1)35-28-12-3-4-13-29(28)36(38-37(35)30-14-5-7-15-32(30)39-38)26-19-20-34-31(22-26)27-11-6-8-16-33(27)40-34/h1-22H/i3D,4D,5D,7D,12D,13D,14D,15D |
| InChIKey | WNQAWEBPJOJJQM-KEPQKETFSA-N |
| XLogP | 11.59 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.71 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |