C21H19ClN4O2 — CID 176777977
7-chloro-8-ethyl-10-(3-phenylpropyl)benzo[g]pteridine-2,4-dione (PubChem CID 176777977) has the molecular formula C21H19ClN4O2 and a molecular weight of 394.86 g/mol. Its IUPAC name is 7-chloro-8-ethyl-10-(3-phenylpropyl)benzo[g]pteridine-2,4-dione.
| Compound Name | 7-chloro-8-ethyl-10-(3-phenylpropyl)benzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 176777977 |
| Molecular Formula | C21H19ClN4O2 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 7-chloro-8-ethyl-10-(3-phenylpropyl)benzo[g]pteridine-2,4-dione |
| SMILES | CCc1cc2c(cc1Cl)nc1c(=O)[nH]c(=O)nc-1n2CCCc1ccccc1 |
| InChI | InChI=1S/C21H19ClN4O2/c1-2-14-11-17-16(12-15(14)22)23-18-19(24-21(28)25-20(18)27)26(17)10-6-9-13-7-4-3-5-8-13/h3-5,7-8,11-12H,2,6,9-10H2,1H3,(H,25,27,28) |
| InChIKey | CTIFCNPFMJFRTL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|