C53H66F2N6O4Si — CID 176778310
CID 176778310 (PubChem CID 176778310) has the molecular formula C53H66F2N6O4Si and a molecular weight of 917.23 g/mol.
| Compound Name | CID 176778310 |
|---|---|
| PubChem CID | 176778310 |
| Molecular Formula | C53H66F2N6O4Si |
| Molecular Weight | 917.23 g/mol |
| Exact Mass | 916.49 |
| IUPAC Name | — |
| SMILES | CC(C)[Si](C#Cc1c(F)ccc2cccc(-c3nc4c5c(nc(OCC67CC8(CC8)CN6CC6(CC6)C7)nc5c3F)N3C[C@H]5CC[C@@H]([C@H]3[C@H](C)O4)N5C(=O)OC(C)(C)C)c12)(C(C)C)C(C)C |
| InChI | InChI=1S/C53H66F2N6O4Si/c1-30(2)66(31(3)4,32(5)6)23-18-36-38(54)16-14-34-12-11-13-37(40(34)36)43-42(55)44-41-46(58-48(57-44)63-29-53-25-51(19-20-51)27-59(53)28-52(26-53)21-22-52)60-24-35-15-17-39(45(60)33(7)64-47(41)56-43)61(35)49(62)65-50(8,9)10/h11-14,16,30-33,35,39,45H,15,17,19-22,24-29H2,1-10H3/t33-,35+,39-,45+/m0/s1 |
| InChIKey | VKJXTDWJMLKNCM-ACDQXSTESA-N |
| XLogP | 11.22 |
| TPSA | 93.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.23 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|