About 1-[[1-(2,2-dimethylpropyl)cyclopropyl]methyl]-3-methylidenepyrrolidine
1-[[1-(2,2-dimethylpropyl)cyclopropyl]methyl]-3-methylidenepyrrolidine (PubChem CID 176778556) has the molecular formula C14H25N
and a molecular weight of 207.36 g/mol. Its IUPAC name is 1-[[1-(2,2-dimethylpropyl)cyclopropyl]methyl]-3-methylidenepyrrolidine.
Molecular Properties
| Compound Name | 1-[[1-(2,2-dimethylpropyl)cyclopropyl]methyl]-3-methylidenepyrrolidine |
| PubChem CID | 176778556 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | 1-[[1-(2,2-dimethylpropyl)cyclopropyl]methyl]-3-methylidenepyrrolidine |
| SMILES | C=C1CCN(CC2(CC(C)(C)C)CC2)C1 |
| InChI | InChI=1S/C14H25N/c1-12-5-8-15(9-12)11-14(6-7-14)10-13(2,3)4/h1,5-11H2,2-4H3 |
| InChIKey | BVLRKDNABMULSC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[[1-(2,2-dimethylpropyl)cyclopropyl]methyl]-3-methylidenepyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[1-(2,2-dimethylpropyl)cyclopropyl]methyl]-3-methylidenepyrrolidine?
The IUPAC name of 1-[[1-(2,2-dimethylpropyl)cyclopropyl]methyl]-3-methylidenepyrrolidine (CID 176778556) is 1-[[1-(2,2-dimethylpropyl)cyclopropyl]methyl]-3-methylidenepyrrolidine.
What is the SMILES notation for 1-[[1-(2,2-dimethylpropyl)cyclopropyl]methyl]-3-methylidenepyrrolidine?
The canonical SMILES for 1-[[1-(2,2-dimethylpropyl)cyclopropyl]methyl]-3-methylidenepyrrolidine is C=C1CCN(CC2(CC(C)(C)C)CC2)C1.
What is the InChIKey of 1-[[1-(2,2-dimethylpropyl)cyclopropyl]methyl]-3-methylidenepyrrolidine?
The InChIKey is BVLRKDNABMULSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N/c1-12-5-8-15(9-12)11-14(6-7-14)10-13(2,3)4/h1,5-11H2,2-4H3.
What are the key properties of 1-[[1-(2,2-dimethylpropyl)cyclopropyl]methyl]-3-methylidenepyrrolidine?
1-[[1-(2,2-dimethylpropyl)cyclopropyl]methyl]-3-methylidenepyrrolidine has a molecular weight of 207.36 g/mol, XLogP of 3.46, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[1-(2,2-dimethylpropyl)cyclopropyl]methyl]-3-methylidenepyrrolidine is sourced from PubChem (CID 176778556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).