C27H25ClF3N9O5 — CID 176780358
[2-(6-chloro-2-methylindazol-5-yl)imino-5-[dideuterio-(1-methyl-1,2,4-triazol-3-yl)methyl]-4,6-dioxo-3-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazinan-1-yl]methyl propan-2-yl carbonate (PubChem CID 176780358) has the molecular formula C27H25ClF3N9O5 and a molecular weight of 650.01 g/mol. Its IUPAC name is [2-(6-chloro-2-methylindazol-5-yl)imino-5-[dideuterio-(1-methyl-1,2,4-triazol-3-yl)methyl]-4,6-dioxo-3-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazinan-1-yl]methyl propan-2-yl carbonate.
| Compound Name | [2-(6-chloro-2-methylindazol-5-yl)imino-5-[dideuterio-(1-methyl-1,2,4-triazol-3-yl)methyl]-4,6-dioxo-3-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazinan-1-yl]methyl propan-2-yl carbonate |
|---|---|
| PubChem CID | 176780358 |
| Molecular Formula | C27H25ClF3N9O5 |
| Molecular Weight | 650.01 g/mol |
| Exact Mass | 649.17 |
| IUPAC Name | [2-(6-chloro-2-methylindazol-5-yl)imino-5-[dideuterio-(1-methyl-1,2,4-triazol-3-yl)methyl]-4,6-dioxo-3-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazinan-1-yl]methyl propan-2-yl carbonate |
| SMILES | [2H]C([2H])(c1ncn(C)n1)n1c(=O)n(COC(=O)OC(C)C)/c(=N\c2cc3cn(C)nc3cc2Cl)n(Cc2cc(F)c(F)cc2F)c1=O |
| InChI | InChI=1S/C27H25ClF3N9O5/c1-14(2)45-27(43)44-13-40-24(33-22-6-16-9-36(3)34-21(16)7-17(22)28)38(10-15-5-19(30)20(31)8-18(15)29)25(41)39(26(40)42)11-23-32-12-37(4)35-23/h5-9,12,14H,10-11,13H2,1-4H3/b33-24-/i11D2 |
| InChIKey | CTJHRIFZLXHCMN-LAEJNGJASA-N |
| XLogP | 2.75 |
| TPSA | 145.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.01 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|