C25H21ClF3N9O4 — CID 176780391
[2-(6-chloro-2-methylindazol-5-yl)imino-5-[dideuterio-(1-methyl-1,2,4-triazol-3-yl)methyl]-4,6-dioxo-3-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazinan-1-yl]methyl acetate (PubChem CID 176780391) has the molecular formula C25H21ClF3N9O4 and a molecular weight of 605.96 g/mol. Its IUPAC name is [2-(6-chloro-2-methylindazol-5-yl)imino-5-[dideuterio-(1-methyl-1,2,4-triazol-3-yl)methyl]-4,6-dioxo-3-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazinan-1-yl]methyl acetate.
| Compound Name | [2-(6-chloro-2-methylindazol-5-yl)imino-5-[dideuterio-(1-methyl-1,2,4-triazol-3-yl)methyl]-4,6-dioxo-3-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazinan-1-yl]methyl acetate |
|---|---|
| PubChem CID | 176780391 |
| Molecular Formula | C25H21ClF3N9O4 |
| Molecular Weight | 605.96 g/mol |
| Exact Mass | 605.15 |
| IUPAC Name | [2-(6-chloro-2-methylindazol-5-yl)imino-5-[dideuterio-(1-methyl-1,2,4-triazol-3-yl)methyl]-4,6-dioxo-3-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazinan-1-yl]methyl acetate |
| SMILES | [2H]C([2H])(c1ncn(C)n1)n1c(=O)n(COC(C)=O)/c(=N\c2cc3cn(C)nc3cc2Cl)n(Cc2cc(F)c(F)cc2F)c1=O |
| InChI | InChI=1S/C25H21ClF3N9O4/c1-13(39)42-12-38-23(31-21-5-15-8-34(2)32-20(15)6-16(21)26)36(9-14-4-18(28)19(29)7-17(14)27)24(40)37(25(38)41)10-22-30-11-35(3)33-22/h4-8,11H,9-10,12H2,1-3H3/b31-23-/i10D2 |
| InChIKey | INEIKVGOEPFLJI-FWBBECQGSA-N |
| XLogP | 1.75 |
| TPSA | 136.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.96 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|