About 7-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-pyrazol-1-ylindazole
7-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-pyrazol-1-ylindazole (PubChem CID 176780864) has the molecular formula C14H13ClN6
and a molecular weight of 300.75 g/mol. Its IUPAC name is 7-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-pyrazol-1-ylindazole.
Molecular Properties
| Compound Name | 7-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-pyrazol-1-ylindazole |
| PubChem CID | 176780864 |
| Molecular Formula | C14H13ClN6 |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 7-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-pyrazol-1-ylindazole |
| SMILES | Clc1cccc2c(-n3cccn3)nn(CC3=NCCN3)c12 |
| InChI | InChI=1S/C14H13ClN6/c15-11-4-1-3-10-13(11)21(9-12-16-6-7-17-12)19-14(10)20-8-2-5-18-20/h1-5,8H,6-7,9H2,(H,16,17) |
| InChIKey | MDNSTFQMABVNKO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-pyrazol-1-ylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-pyrazol-1-ylindazole?
The IUPAC name of 7-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-pyrazol-1-ylindazole (CID 176780864) is 7-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-pyrazol-1-ylindazole.
What is the SMILES notation for 7-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-pyrazol-1-ylindazole?
The canonical SMILES for 7-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-pyrazol-1-ylindazole is Clc1cccc2c(-n3cccn3)nn(CC3=NCCN3)c12.
What is the InChIKey of 7-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-pyrazol-1-ylindazole?
The InChIKey is MDNSTFQMABVNKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13ClN6/c15-11-4-1-3-10-13(11)21(9-12-16-6-7-17-12)19-14(10)20-8-2-5-18-20/h1-5,8H,6-7,9H2,(H,16,17).
What are the key properties of 7-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-pyrazol-1-ylindazole?
7-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-pyrazol-1-ylindazole has a molecular weight of 300.75 g/mol, XLogP of 1.88, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)-3-pyrazol-1-ylindazole is sourced from PubChem (CID 176780864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).