C49H41NO — CID 176781201
N-(2-tert-butyl-4-dibenzofuran-3-ylphenyl)-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine (PubChem CID 176781201) has the molecular formula C49H41NO and a molecular weight of 659.87 g/mol. Its IUPAC name is N-(2-tert-butyl-4-dibenzofuran-3-ylphenyl)-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine.
| Compound Name | N-(2-tert-butyl-4-dibenzofuran-3-ylphenyl)-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 176781201 |
| Molecular Formula | C49H41NO |
| Molecular Weight | 659.87 g/mol |
| Exact Mass | 659.32 |
| IUPAC Name | N-(2-tert-butyl-4-dibenzofuran-3-ylphenyl)-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine |
| SMILES | CC(C)(C)c1cc(-c2ccc3c(c2)oc2ccccc23)ccc1N(c1ccc(-c2ccccc2)cc1)c1ccc2c(c1)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C49H41NO/c1-48(2,3)44-29-34(35-21-26-41-40-16-10-12-18-46(40)51-47(41)30-35)22-28-45(44)50(36-23-19-33(20-24-36)32-13-7-6-8-14-32)37-25-27-39-38-15-9-11-17-42(38)49(4,5)43(39)31-37/h6-31H,1-5H3 |
| InChIKey | LLXWVXSQWPQXBF-UHFFFAOYSA-N |
| XLogP | 13.99 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.87 |
| LogP ≤ 5 | 13.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |