C27H45NO4 — CID 176781395
1'-(2,2-diethoxyethyl)-5,6-bis(propan-2-yloxymethyl)spiro[1,3-dihydroindene-2,4'-piperidine] (PubChem CID 176781395) has the molecular formula C27H45NO4 and a molecular weight of 447.66 g/mol. Its IUPAC name is 1'-(2,2-diethoxyethyl)-5,6-bis(propan-2-yloxymethyl)spiro[1,3-dihydroindene-2,4'-piperidine].
| Compound Name | 1'-(2,2-diethoxyethyl)-5,6-bis(propan-2-yloxymethyl)spiro[1,3-dihydroindene-2,4'-piperidine] |
|---|---|
| PubChem CID | 176781395 |
| Molecular Formula | C27H45NO4 |
| Molecular Weight | 447.66 g/mol |
| Exact Mass | 447.33 |
| IUPAC Name | 1'-(2,2-diethoxyethyl)-5,6-bis(propan-2-yloxymethyl)spiro[1,3-dihydroindene-2,4'-piperidine] |
| SMILES | CCOC(CN1CCC2(CC1)Cc1cc(COC(C)C)c(COC(C)C)cc1C2)OCC |
| InChI | InChI=1S/C27H45NO4/c1-7-29-26(30-8-2)17-28-11-9-27(10-12-28)15-22-13-24(18-31-20(3)4)25(14-23(22)16-27)19-32-21(5)6/h13-14,20-21,26H,7-12,15-19H2,1-6H3 |
| InChIKey | GWBPAVCMJVERCX-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.66 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|