About CID 176782228
CID 176782228 (PubChem CID 176782228) has the molecular formula C46H30N5OPtS-3
and a molecular weight of 895.93 g/mol.
Molecular Properties
| Compound Name | CID 176782228 |
| PubChem CID | 176782228 |
| Molecular Formula | C46H30N5OPtS-3 |
| Molecular Weight | 895.93 g/mol |
| Exact Mass | 895.18 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(N2[CH-]N(c3[c-]c(Oc4[c-]c5c(cc4)c4cccnc4n4c6ccccc6nc54)cc4sc5ccccc5c34)c3ccccc32)c(C)c1.[Pt] |
| InChI | InChI=1S/C46H30N5OS.Pt/c1-27-21-28(2)44(29(3)22-27)50-26-49(38-15-7-8-16-39(38)50)40-24-31(25-42-43(40)34-11-4-9-17-41(34)53-42)52-30-18-19-32-33-12-10-20-47-45(33)51-37-14-6-5-13-36(37)48-46(51)35(32)23-30;/h4-22,25-26H,1-3H3;/q-3; |
| InChIKey | STKQUMXBZZBACB-UHFFFAOYSA-N |
| XLogP | 12.28 |
| TPSA | 45.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 895.93 |
| LogP ≤ 5 | 12.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 176782228 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176782228?
The IUPAC name of CID 176782228 (CID 176782228) is not available.
What is the SMILES notation for CID 176782228?
The canonical SMILES for CID 176782228 is Cc1cc(C)c(N2[CH-]N(c3[c-]c(Oc4[c-]c5c(cc4)c4cccnc4n4c6ccccc6nc54)cc4sc5ccccc5c34)c3ccccc32)c(C)c1.[Pt].
What is the InChIKey of CID 176782228?
The InChIKey is STKQUMXBZZBACB-UHFFFAOYSA-N. The full InChI is InChI=1S/C46H30N5OS.Pt/c1-27-21-28(2)44(29(3)22-27)50-26-49(38-15-7-8-16-39(38)50)40-24-31(25-42-43(40)34-11-4-9-17-41(34)53-42)52-30-18-19-32-33-12-10-20-47-45(33)51-37-14-6-5-13-36(37)48-46(51)35(32)23-30;/h4-22,25-26H,1-3H3;/q-3;.
What are the key properties of CID 176782228?
CID 176782228 has a molecular weight of 895.93 g/mol, XLogP of 12.28, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176782228 is sourced from PubChem (CID 176782228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).