C43H57ClN2 — CID 176782674
N-[4-tert-butyl-2,6-bis(2,5-ditert-butylphenyl)phenyl]-2-chloropyridin-3-amine (PubChem CID 176782674) has the molecular formula C43H57ClN2 and a molecular weight of 637.40 g/mol. Its IUPAC name is N-[4-tert-butyl-2,6-bis(2,5-ditert-butylphenyl)phenyl]-2-chloropyridin-3-amine.
| Compound Name | N-[4-tert-butyl-2,6-bis(2,5-ditert-butylphenyl)phenyl]-2-chloropyridin-3-amine |
|---|---|
| PubChem CID | 176782674 |
| Molecular Formula | C43H57ClN2 |
| Molecular Weight | 637.40 g/mol |
| Exact Mass | 636.42 |
| IUPAC Name | N-[4-tert-butyl-2,6-bis(2,5-ditert-butylphenyl)phenyl]-2-chloropyridin-3-amine |
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)c(-c2cc(C(C)(C)C)cc(-c3cc(C(C)(C)C)ccc3C(C)(C)C)c2Nc2cccnc2Cl)c1 |
| InChI | InChI=1S/C43H57ClN2/c1-39(2,3)27-18-20-34(42(10,11)12)30(23-27)32-25-29(41(7,8)9)26-33(37(32)46-36-17-16-22-45-38(36)44)31-24-28(40(4,5)6)19-21-35(31)43(13,14)15/h16-26,46H,1-15H3 |
| InChIKey | VSQVPDOXKHHZGB-UHFFFAOYSA-N |
| XLogP | 13.30 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.40 |
| LogP ≤ 5 | 13.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|