C57H48N4O2 — CID 176782972
12-(4-tert-butyl-2-pyridinyl)-2-[3-[4,5-diphenyl-3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]phenoxy]-[1]benzofuro[2,3-a]carbazole (PubChem CID 176782972) has the molecular formula C57H48N4O2 and a molecular weight of 821.04 g/mol. Its IUPAC name is 12-(4-tert-butyl-2-pyridinyl)-2-[3-[4,5-diphenyl-3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]phenoxy]-[1]benzofuro[2,3-a]carbazole.
| Compound Name | 12-(4-tert-butyl-2-pyridinyl)-2-[3-[4,5-diphenyl-3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]phenoxy]-[1]benzofuro[2,3-a]carbazole |
|---|---|
| PubChem CID | 176782972 |
| Molecular Formula | C57H48N4O2 |
| Molecular Weight | 821.04 g/mol |
| Exact Mass | 820.38 |
| IUPAC Name | 12-(4-tert-butyl-2-pyridinyl)-2-[3-[4,5-diphenyl-3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]phenoxy]-[1]benzofuro[2,3-a]carbazole |
| SMILES | Cc1cc(C)c(N2CN(c3cccc(Oc4ccc5c6ccc7c8ccccc8oc7c6n(-c6cc(C(C)(C)C)ccn6)c5c4)c3)C(c3ccccc3)=C2c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C57H48N4O2/c1-36-30-37(2)52(38(3)31-36)60-35-59(53(39-16-9-7-10-17-39)54(60)40-18-11-8-12-19-40)42-20-15-21-43(33-42)62-44-24-25-45-47-26-27-48-46-22-13-14-23-50(46)63-56(48)55(47)61(49(45)34-44)51-32-41(28-29-58-51)57(4,5)6/h7-34H,35H2,1-6H3 |
| InChIKey | KCYQKNVATGUATR-UHFFFAOYSA-N |
| XLogP | 14.90 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.04 |
| LogP ≤ 5 | 14.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|