C45H36N4O2Pt — CID 176783822
CID 176783822 (PubChem CID 176783822) has the molecular formula C45H36N4O2Pt and a molecular weight of 859.89 g/mol.
| Compound Name | CID 176783822 |
|---|---|
| PubChem CID | 176783822 |
| Molecular Formula | C45H36N4O2Pt |
| Molecular Weight | 859.89 g/mol |
| Exact Mass | 859.25 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(-c2ccn(-c3[c-]c(Oc4[c-]c5c(c6ccccc6n5-c5cc(C(C)(C)C)ccn5)c5c4oc4ccccc45)ccc3)n2)c(C)c1.[Pt+2] |
| InChI | InChI=1S/C45H36N4O2.Pt/c1-27-22-28(2)41(29(3)23-27)35-19-21-48(47-35)31-12-11-13-32(25-31)50-39-26-37-42(43-34-15-8-10-17-38(34)51-44(39)43)33-14-7-9-16-36(33)49(37)40-24-30(18-20-46-40)45(4,5)6;/h7-24H,1-6H3;/q-2;+2 |
| InChIKey | STCAITQPZLXRHU-UHFFFAOYSA-N |
| XLogP | 11.54 |
| TPSA | 58.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.89 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|