C54H65BN2 — CID 176786388
4,11,18-tritert-butyl-8,14-bis(4-cyclohexylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene (PubChem CID 176786388) has the molecular formula C54H65BN2 and a molecular weight of 752.94 g/mol. Its IUPAC name is 4,11,18-tritert-butyl-8,14-bis(4-cyclohexylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 4,11,18-tritert-butyl-8,14-bis(4-cyclohexylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 176786388 |
| Molecular Formula | C54H65BN2 |
| Molecular Weight | 752.94 g/mol |
| Exact Mass | 752.52 |
| IUPAC Name | 4,11,18-tritert-butyl-8,14-bis(4-cyclohexylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
| SMILES | CC(C)(C)c1ccc2c(c1)B1c3cc(C(C)(C)C)ccc3N(c3ccc(C4CCCCC4)cc3)c3cc(C(C)(C)C)cc(c31)N2c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C54H65BN2/c1-52(2,3)40-24-30-47-45(32-40)55-46-33-41(53(4,5)6)25-31-48(46)57(44-28-22-39(23-29-44)37-18-14-11-15-19-37)50-35-42(54(7,8)9)34-49(51(50)55)56(47)43-26-20-38(21-27-43)36-16-12-10-13-17-36/h20-37H,10-19H2,1-9H3 |
| InChIKey | HNVJZBKWQJOPLH-UHFFFAOYSA-N |
| XLogP | 13.76 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.94 |
| LogP ≤ 5 | 13.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|