C39H28N3O+ — CID 176787602
3-[8-(2,6-diphenylpyrimidin-4-yl)-3-methyldibenzofuran-4-yl]-2-methylisoquinolin-2-ium (PubChem CID 176787602) has the molecular formula C39H28N3O+ and a molecular weight of 554.67 g/mol. Its IUPAC name is 3-[8-(2,6-diphenylpyrimidin-4-yl)-3-methyldibenzofuran-4-yl]-2-methylisoquinolin-2-ium.
| Compound Name | 3-[8-(2,6-diphenylpyrimidin-4-yl)-3-methyldibenzofuran-4-yl]-2-methylisoquinolin-2-ium |
|---|---|
| PubChem CID | 176787602 |
| Molecular Formula | C39H28N3O+ |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | 3-[8-(2,6-diphenylpyrimidin-4-yl)-3-methyldibenzofuran-4-yl]-2-methylisoquinolin-2-ium |
| SMILES | Cc1ccc2c(oc3ccc(-c4cc(-c5ccccc5)nc(-c5ccccc5)n4)cc32)c1-c1cc2ccccc2c[n+]1C |
| InChI | InChI=1S/C39H28N3O/c1-25-17-19-31-32-21-29(34-23-33(26-11-5-3-6-12-26)40-39(41-34)27-13-7-4-8-14-27)18-20-36(32)43-38(31)37(25)35-22-28-15-9-10-16-30(28)24-42(35)2/h3-24H,1-2H3/q+1 |
| InChIKey | ZCNAFPHKYAOTFR-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 42.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|