C15H28O6 — CID 176788715
1-[[(3S,6R)-6-(2-methoxybutoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]butan-2-ol (PubChem CID 176788715) has the molecular formula C15H28O6 and a molecular weight of 304.38 g/mol. Its IUPAC name is 1-[[(3S,6R)-6-(2-methoxybutoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]butan-2-ol.
| Compound Name | 1-[[(3S,6R)-6-(2-methoxybutoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]butan-2-ol |
|---|---|
| PubChem CID | 176788715 |
| Molecular Formula | C15H28O6 |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 1-[[(3S,6R)-6-(2-methoxybutoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]butan-2-ol |
| SMILES | CCC(O)CO[C@H]1COC2C1OC[C@H]2OCC(CC)OC |
| InChI | InChI=1S/C15H28O6/c1-4-10(16)6-18-12-8-20-15-13(9-21-14(12)15)19-7-11(5-2)17-3/h10-16H,4-9H2,1-3H3/t10?,11?,12-,13+,14?,15?/m0/s1 |
| InChIKey | RNMQQGOTVOSJKU-ZTQFERANSA-N |
| XLogP | 0.75 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |