C20H18F2O — CID 176789425
7-[4-(2,2-difluoroethenyl)-2,6-dimethylphenyl]-2,3-dihydro-1H-indene-5-carbaldehyde (PubChem CID 176789425) has the molecular formula C20H18F2O and a molecular weight of 312.36 g/mol. Its IUPAC name is 7-[4-(2,2-difluoroethenyl)-2,6-dimethylphenyl]-2,3-dihydro-1H-indene-5-carbaldehyde.
| Compound Name | 7-[4-(2,2-difluoroethenyl)-2,6-dimethylphenyl]-2,3-dihydro-1H-indene-5-carbaldehyde |
|---|---|
| PubChem CID | 176789425 |
| Molecular Formula | C20H18F2O |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 7-[4-(2,2-difluoroethenyl)-2,6-dimethylphenyl]-2,3-dihydro-1H-indene-5-carbaldehyde |
| SMILES | Cc1cc(C=C(F)F)cc(C)c1-c1cc(C=O)cc2c1CCC2 |
| InChI | InChI=1S/C20H18F2O/c1-12-6-14(10-19(21)22)7-13(2)20(12)18-9-15(11-23)8-16-4-3-5-17(16)18/h6-11H,3-5H2,1-2H3 |
| InChIKey | RCPNCDRYHQXVFL-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|