C21H26ClN3O — CID 176790760
(1R,2'S)-7-chloro-1'-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-ylmethyl)-2'-methylspiro[3,4-dihydroisochromene-1,4'-piperidine] (PubChem CID 176790760) has the molecular formula C21H26ClN3O and a molecular weight of 371.91 g/mol. Its IUPAC name is (1R,2'S)-7-chloro-1'-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-ylmethyl)-2'-methylspiro[3,4-dihydroisochromene-1,4'-piperidine].
| Compound Name | (1R,2'S)-7-chloro-1'-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-ylmethyl)-2'-methylspiro[3,4-dihydroisochromene-1,4'-piperidine] |
|---|---|
| PubChem CID | 176790760 |
| Molecular Formula | C21H26ClN3O |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | (1R,2'S)-7-chloro-1'-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-ylmethyl)-2'-methylspiro[3,4-dihydroisochromene-1,4'-piperidine] |
| SMILES | C[C@H]1C[C@@]2(CCN1Cc1cnn3c1CCC3)OCCc1ccc(Cl)cc12 |
| InChI | InChI=1S/C21H26ClN3O/c1-15-12-21(19-11-18(22)5-4-16(19)6-10-26-21)7-9-24(15)14-17-13-23-25-8-2-3-20(17)25/h4-5,11,13,15H,2-3,6-10,12,14H2,1H3/t15-,21+/m0/s1 |
| InChIKey | AIUFLMMMEPMTJV-YCRPNKLZSA-N |
| XLogP | 3.94 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |