C20H22N4O2 — CID 176790921
N-(4-hydroxycyclohexyl)-5-[1-(trideuteriomethyl)indazol-3-yl]pyridine-2-carboxamide (PubChem CID 176790921) has the molecular formula C20H22N4O2 and a molecular weight of 353.44 g/mol. Its IUPAC name is N-(4-hydroxycyclohexyl)-5-[1-(trideuteriomethyl)indazol-3-yl]pyridine-2-carboxamide.
| Compound Name | N-(4-hydroxycyclohexyl)-5-[1-(trideuteriomethyl)indazol-3-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 176790921 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | N-(4-hydroxycyclohexyl)-5-[1-(trideuteriomethyl)indazol-3-yl]pyridine-2-carboxamide |
| SMILES | [2H]C([2H])([2H])n1nc(-c2ccc(C(=O)NC3CCC(O)CC3)nc2)c2ccccc21 |
| InChI | InChI=1S/C20H22N4O2/c1-24-18-5-3-2-4-16(18)19(23-24)13-6-11-17(21-12-13)20(26)22-14-7-9-15(25)10-8-14/h2-6,11-12,14-15,25H,7-10H2,1H3,(H,22,26)/i1D3 |
| InChIKey | HSAGIDDONRTHTB-FIBGUPNXSA-N |
| XLogP | 2.67 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |