C26H46 — CID 176792744
2,4,5,7,10,11,15,17-octamethyltetracyclo[12.4.0.03,7.08,10]octadecane (PubChem CID 176792744) has the molecular formula C26H46 and a molecular weight of 358.65 g/mol. Its IUPAC name is 2,4,5,7,10,11,15,17-octamethyltetracyclo[12.4.0.03,7.08,10]octadecane.
| Compound Name | 2,4,5,7,10,11,15,17-octamethyltetracyclo[12.4.0.03,7.08,10]octadecane |
|---|---|
| PubChem CID | 176792744 |
| Molecular Formula | C26H46 |
| Molecular Weight | 358.65 g/mol |
| Exact Mass | 358.36 |
| IUPAC Name | 2,4,5,7,10,11,15,17-octamethyltetracyclo[12.4.0.03,7.08,10]octadecane |
| SMILES | CC1CC(C)C2CCC(C)C3(C)CC3C3(C)CC(C)C(C)C3C(C)C2C1 |
| InChI | InChI=1S/C26H46/c1-15-11-16(2)21-10-9-18(4)25(7)14-23(25)26(8)13-17(3)19(5)24(26)20(6)22(21)12-15/h15-24H,9-14H2,1-8H3 |
| InChIKey | FPNJTINSJXHTAN-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.65 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |