C18H29NO3 — CID 176792793
(2E,4E,9E,11E)-8,13-dihydroxy-N-(2-methylpropyl)tetradeca-2,4,9,11-tetraenamide (PubChem CID 176792793) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is (2E,4E,9E,11E)-8,13-dihydroxy-N-(2-methylpropyl)tetradeca-2,4,9,11-tetraenamide.
| Compound Name | (2E,4E,9E,11E)-8,13-dihydroxy-N-(2-methylpropyl)tetradeca-2,4,9,11-tetraenamide |
|---|---|
| PubChem CID | 176792793 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | (2E,4E,9E,11E)-8,13-dihydroxy-N-(2-methylpropyl)tetradeca-2,4,9,11-tetraenamide |
| SMILES | CC(O)/C=C/C=C/C(O)CC/C=C/C=C/C(=O)NCC(C)C |
| InChI | InChI=1S/C18H29NO3/c1-15(2)14-19-18(22)13-7-5-4-6-11-17(21)12-9-8-10-16(3)20/h4-5,7-10,12-13,15-17,20-21H,6,11,14H2,1-3H3,(H,19,22)/b5-4+,10-8+,12-9+,13-7+ |
| InChIKey | YBWQRWPZQDEHEI-SOHRNAHQSA-N |
| XLogP | 2.51 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|