C16H25NO3 — CID 176792796
(2E,7E,9E)-6-hydroxy-N-(2-methylpropyl)-11-oxododeca-2,7,9-trienamide (PubChem CID 176792796) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is (2E,7E,9E)-6-hydroxy-N-(2-methylpropyl)-11-oxododeca-2,7,9-trienamide.
| Compound Name | (2E,7E,9E)-6-hydroxy-N-(2-methylpropyl)-11-oxododeca-2,7,9-trienamide |
|---|---|
| PubChem CID | 176792796 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | (2E,7E,9E)-6-hydroxy-N-(2-methylpropyl)-11-oxododeca-2,7,9-trienamide |
| SMILES | CC(=O)/C=C/C=C/C(O)CC/C=C/C(=O)NCC(C)C |
| InChI | InChI=1S/C16H25NO3/c1-13(2)12-17-16(20)11-7-6-10-15(19)9-5-4-8-14(3)18/h4-5,7-9,11,13,15,19H,6,10,12H2,1-3H3,(H,17,20)/b8-4+,9-5+,11-7+ |
| InChIKey | SUQQIVKCWULNNY-LPPZWSRQSA-N |
| XLogP | 2.16 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|