C45H32N2 — CID 176795074
2-[2,3,5,6,7,8-hexadeuterio-4-(11,11-dimethylbenzo[b]fluoren-4-yl)naphthalen-1-yl]-4,6-bis(2,3,4,5,6-pentadeuteriophenyl)pyrimidine (PubChem CID 176795074) has the molecular formula C45H32N2 and a molecular weight of 616.86 g/mol. Its IUPAC name is 2-[2,3,5,6,7,8-hexadeuterio-4-(11,11-dimethylbenzo[b]fluoren-4-yl)naphthalen-1-yl]-4,6-bis(2,3,4,5,6-pentadeuteriophenyl)pyrimidine.
| Compound Name | 2-[2,3,5,6,7,8-hexadeuterio-4-(11,11-dimethylbenzo[b]fluoren-4-yl)naphthalen-1-yl]-4,6-bis(2,3,4,5,6-pentadeuteriophenyl)pyrimidine |
|---|---|
| PubChem CID | 176795074 |
| Molecular Formula | C45H32N2 |
| Molecular Weight | 616.86 g/mol |
| Exact Mass | 616.36 |
| IUPAC Name | 2-[2,3,5,6,7,8-hexadeuterio-4-(11,11-dimethylbenzo[b]fluoren-4-yl)naphthalen-1-yl]-4,6-bis(2,3,4,5,6-pentadeuteriophenyl)pyrimidine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])nc(-c3c([2H])c([2H])c(-c4cccc5c4-c4cc6ccccc6cc4C5(C)C)c4c([2H])c([2H])c([2H])c([2H])c34)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C45H32N2/c1-45(2)39-23-13-22-36(43(39)38-26-31-18-9-10-19-32(31)27-40(38)45)35-24-25-37(34-21-12-11-20-33(34)35)44-46-41(29-14-5-3-6-15-29)28-42(47-44)30-16-7-4-8-17-30/h3-28H,1-2H3/i3D,4D,5D,6D,7D,8D,11D,12D,14D,15D,16D,17D,20D,21D,24D,25D |
| InChIKey | KYVORPIDOXJDOS-FKAQMUTOSA-N |
| XLogP | 11.76 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.86 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |