C22H41N3O — CID 176796856
[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]-(4-propan-2-ylpiperazin-1-yl)methanone (PubChem CID 176796856) has the molecular formula C22H41N3O and a molecular weight of 363.59 g/mol. Its IUPAC name is [1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]-(4-propan-2-ylpiperazin-1-yl)methanone.
| Compound Name | [1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]-(4-propan-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 176796856 |
| Molecular Formula | C22H41N3O |
| Molecular Weight | 363.59 g/mol |
| Exact Mass | 363.32 |
| IUPAC Name | [1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]-(4-propan-2-ylpiperazin-1-yl)methanone |
| SMILES | CC(C)C1CCC(N2CCC(C(=O)N3CCN(C(C)C)CC3)CC2)CC1 |
| InChI | InChI=1S/C22H41N3O/c1-17(2)19-5-7-21(8-6-19)24-11-9-20(10-12-24)22(26)25-15-13-23(14-16-25)18(3)4/h17-21H,5-16H2,1-4H3 |
| InChIKey | OSBIBQLNSDSNOU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.59 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |