About 1-ethyl-3,3-difluoro-4-(2-methylpropyl)pyrrolidin-2-one
1-ethyl-3,3-difluoro-4-(2-methylpropyl)pyrrolidin-2-one (PubChem CID 176797213) has the molecular formula C10H17F2NO
and a molecular weight of 205.25 g/mol. Its IUPAC name is 1-ethyl-3,3-difluoro-4-(2-methylpropyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-ethyl-3,3-difluoro-4-(2-methylpropyl)pyrrolidin-2-one |
| PubChem CID | 176797213 |
| Molecular Formula | C10H17F2NO |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 1-ethyl-3,3-difluoro-4-(2-methylpropyl)pyrrolidin-2-one |
| SMILES | CCN1CC(CC(C)C)C(F)(F)C1=O |
| InChI | InChI=1S/C10H17F2NO/c1-4-13-6-8(5-7(2)3)10(11,12)9(13)14/h7-8H,4-6H2,1-3H3 |
| InChIKey | UDSAUWPUADSMDT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethyl-3,3-difluoro-4-(2-methylpropyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3,3-difluoro-4-(2-methylpropyl)pyrrolidin-2-one?
The IUPAC name of 1-ethyl-3,3-difluoro-4-(2-methylpropyl)pyrrolidin-2-one (CID 176797213) is 1-ethyl-3,3-difluoro-4-(2-methylpropyl)pyrrolidin-2-one.
What is the SMILES notation for 1-ethyl-3,3-difluoro-4-(2-methylpropyl)pyrrolidin-2-one?
The canonical SMILES for 1-ethyl-3,3-difluoro-4-(2-methylpropyl)pyrrolidin-2-one is CCN1CC(CC(C)C)C(F)(F)C1=O.
What is the InChIKey of 1-ethyl-3,3-difluoro-4-(2-methylpropyl)pyrrolidin-2-one?
The InChIKey is UDSAUWPUADSMDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F2NO/c1-4-13-6-8(5-7(2)3)10(11,12)9(13)14/h7-8H,4-6H2,1-3H3.
What are the key properties of 1-ethyl-3,3-difluoro-4-(2-methylpropyl)pyrrolidin-2-one?
1-ethyl-3,3-difluoro-4-(2-methylpropyl)pyrrolidin-2-one has a molecular weight of 205.25 g/mol, XLogP of 2.15, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3,3-difluoro-4-(2-methylpropyl)pyrrolidin-2-one is sourced from PubChem (CID 176797213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).