C41H49N7O5 — CID 176797259
2-[4-[2-[4-[4-[1-(1-cyclopropyl-2-oxo-3-pyridinyl)-2,6-dioxopiperidin-3-yl]-3-methylphenyl]piperazin-1-yl]ethyl]cyclohexyl]-6-methoxyindazole-5-carboxamide (PubChem CID 176797259) has the molecular formula C41H49N7O5 and a molecular weight of 719.89 g/mol. Its IUPAC name is 2-[4-[2-[4-[4-[1-(1-cyclopropyl-2-oxo-3-pyridinyl)-2,6-dioxopiperidin-3-yl]-3-methylphenyl]piperazin-1-yl]ethyl]cyclohexyl]-6-methoxyindazole-5-carboxamide.
| Compound Name | 2-[4-[2-[4-[4-[1-(1-cyclopropyl-2-oxo-3-pyridinyl)-2,6-dioxopiperidin-3-yl]-3-methylphenyl]piperazin-1-yl]ethyl]cyclohexyl]-6-methoxyindazole-5-carboxamide |
|---|---|
| PubChem CID | 176797259 |
| Molecular Formula | C41H49N7O5 |
| Molecular Weight | 719.89 g/mol |
| Exact Mass | 719.38 |
| IUPAC Name | 2-[4-[2-[4-[4-[1-(1-cyclopropyl-2-oxo-3-pyridinyl)-2,6-dioxopiperidin-3-yl]-3-methylphenyl]piperazin-1-yl]ethyl]cyclohexyl]-6-methoxyindazole-5-carboxamide |
| SMILES | COc1cc2nn(C3CCC(CCN4CCN(c5ccc(C6CCC(=O)N(c7cccn(C8CC8)c7=O)C6=O)c(C)c5)CC4)CC3)cc2cc1C(N)=O |
| InChI | InChI=1S/C41H49N7O5/c1-26-22-31(11-12-32(26)33-13-14-38(49)48(40(33)51)36-4-3-16-46(41(36)52)29-9-10-29)45-20-18-44(19-21-45)17-15-27-5-7-30(8-6-27)47-25-28-23-34(39(42)50)37(53-2)24-35(28)43-47/h3-4,11-12,16,22-25,27,29-30,33H,5-10,13-15,17-21H2,1-2H3,(H2,42,50) |
| InChIKey | VEYLWNLSJPYWKJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 136.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.89 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|