C17H20N2O2 — CID 176797412
(1R,11R,12R,15R)-12-methyl-3,13-diazapentacyclo[13.2.1.02,10.04,9.013,17]octadeca-2(10),4(9),5,7-tetraene-7,11-diol (PubChem CID 176797412) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is (1R,11R,12R,15R)-12-methyl-3,13-diazapentacyclo[13.2.1.02,10.04,9.013,17]octadeca-2(10),4(9),5,7-tetraene-7,11-diol.
| Compound Name | (1R,11R,12R,15R)-12-methyl-3,13-diazapentacyclo[13.2.1.02,10.04,9.013,17]octadeca-2(10),4(9),5,7-tetraene-7,11-diol |
|---|---|
| PubChem CID | 176797412 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | (1R,11R,12R,15R)-12-methyl-3,13-diazapentacyclo[13.2.1.02,10.04,9.013,17]octadeca-2(10),4(9),5,7-tetraene-7,11-diol |
| SMILES | C[C@@H]1[C@H](O)c2c([nH]c3ccc(O)cc23)[C@@H]2C[C@@H]3CC2N1C3 |
| InChI | InChI=1S/C17H20N2O2/c1-8-17(21)15-11-6-10(20)2-3-13(11)18-16(15)12-4-9-5-14(12)19(8)7-9/h2-3,6,8-9,12,14,17-18,20-21H,4-5,7H2,1H3/t8-,9-,12-,14?,17+/m1/s1 |
| InChIKey | FFSUBABDVBFVNJ-WGZZFALGSA-N |
| XLogP | 2.49 |
| TPSA | 59.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |