C18H21NO3 — CID 176797433
[(1R,15R)-7-methoxy-3-oxa-13-azapentacyclo[13.2.1.02,10.04,9.013,17]octadeca-2(10),4(9),5,7-tetraen-14-yl]methanol (PubChem CID 176797433) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is [(1R,15R)-7-methoxy-3-oxa-13-azapentacyclo[13.2.1.02,10.04,9.013,17]octadeca-2(10),4(9),5,7-tetraen-14-yl]methanol.
| Compound Name | [(1R,15R)-7-methoxy-3-oxa-13-azapentacyclo[13.2.1.02,10.04,9.013,17]octadeca-2(10),4(9),5,7-tetraen-14-yl]methanol |
|---|---|
| PubChem CID | 176797433 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | [(1R,15R)-7-methoxy-3-oxa-13-azapentacyclo[13.2.1.02,10.04,9.013,17]octadeca-2(10),4(9),5,7-tetraen-14-yl]methanol |
| SMILES | COc1ccc2oc3c(c2c1)CCN1C(CO)[C@H]2CC1[C@H]3C2 |
| InChI | InChI=1S/C18H21NO3/c1-21-11-2-3-17-13(8-11)12-4-5-19-15-7-10(16(19)9-20)6-14(15)18(12)22-17/h2-3,8,10,14-16,20H,4-7,9H2,1H3/t10-,14-,15?,16?/m1/s1 |
| InChIKey | SUWAXDWXEDRRGL-SFWZDCPZSA-N |
| XLogP | 2.54 |
| TPSA | 45.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |