C27H30N2O10S2 — CID 176797566
3-[[3-[5-(2,2-dimethylpropanoyl)-1,3-benzoxazol-2-yl]-2-oxochromen-7-yl]-(3-sulfopropyl)amino]propane-1-sulfonic acid (PubChem CID 176797566) has the molecular formula C27H30N2O10S2 and a molecular weight of 606.68 g/mol. Its IUPAC name is 3-[[3-[5-(2,2-dimethylpropanoyl)-1,3-benzoxazol-2-yl]-2-oxochromen-7-yl]-(3-sulfopropyl)amino]propane-1-sulfonic acid.
| Compound Name | 3-[[3-[5-(2,2-dimethylpropanoyl)-1,3-benzoxazol-2-yl]-2-oxochromen-7-yl]-(3-sulfopropyl)amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 176797566 |
| Molecular Formula | C27H30N2O10S2 |
| Molecular Weight | 606.68 g/mol |
| Exact Mass | 606.13 |
| IUPAC Name | 3-[[3-[5-(2,2-dimethylpropanoyl)-1,3-benzoxazol-2-yl]-2-oxochromen-7-yl]-(3-sulfopropyl)amino]propane-1-sulfonic acid |
| SMILES | CC(C)(C)C(=O)c1ccc2oc(-c3cc4ccc(N(CCCS(=O)(=O)O)CCCS(=O)(=O)O)cc4oc3=O)nc2c1 |
| InChI | InChI=1S/C27H30N2O10S2/c1-27(2,3)24(30)18-7-9-22-21(15-18)28-25(38-22)20-14-17-6-8-19(16-23(17)39-26(20)31)29(10-4-12-40(32,33)34)11-5-13-41(35,36)37/h6-9,14-16H,4-5,10-13H2,1-3H3,(H,32,33,34)(H,35,36,37) |
| InChIKey | KEWGXLHPPUWWQY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 185.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.68 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|