C55H38N4O — CID 176797781
2-[3-[3-(2,6-diphenylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-9-[5-(2,3,4,5,6-pentadeuteriophenyl)-4-(trideuteriomethyl)-2-pyridinyl]carbazole (PubChem CID 176797781) has the molecular formula C55H38N4O and a molecular weight of 778.98 g/mol. Its IUPAC name is 2-[3-[3-(2,6-diphenylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-9-[5-(2,3,4,5,6-pentadeuteriophenyl)-4-(trideuteriomethyl)-2-pyridinyl]carbazole.
| Compound Name | 2-[3-[3-(2,6-diphenylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-9-[5-(2,3,4,5,6-pentadeuteriophenyl)-4-(trideuteriomethyl)-2-pyridinyl]carbazole |
|---|---|
| PubChem CID | 176797781 |
| Molecular Formula | C55H38N4O |
| Molecular Weight | 778.98 g/mol |
| Exact Mass | 778.35 |
| IUPAC Name | 2-[3-[3-(2,6-diphenylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-9-[5-(2,3,4,5,6-pentadeuteriophenyl)-4-(trideuteriomethyl)-2-pyridinyl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cnc(-n3c4ccccc4c4ccc(Oc5cccc(-n6[c-][n+](-c7c(-c8ccccc8)cccc7-c7ccccc7)c7ccccc76)c5)cc43)cc2C([2H])([2H])[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C55H38N4O/c1-38-33-54(56-36-49(38)41-21-9-4-10-22-41)59-50-28-12-11-25-47(50)48-32-31-44(35-53(48)59)60-43-24-15-23-42(34-43)57-37-58(52-30-14-13-29-51(52)57)55-45(39-17-5-2-6-18-39)26-16-27-46(55)40-19-7-3-8-20-40/h2-36H,1H3/i1D3,4D,9D,10D,21D,22D |
| InChIKey | IJFFELYDZQDFGI-BTMZIEDVSA-N |
| XLogP | 13.30 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.98 |
| LogP ≤ 5 | 13.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|