C32H46N2O7S — CID 176798626
(2R)-2-[3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]phenyl]-7-(2-hydroxyethylsulfonyl)-N',2,6,6-tetramethyl-N'-phenacylheptanehydrazide (PubChem CID 176798626) has the molecular formula C32H46N2O7S and a molecular weight of 602.79 g/mol. Its IUPAC name is (2R)-2-[3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]phenyl]-7-(2-hydroxyethylsulfonyl)-N',2,6,6-tetramethyl-N'-phenacylheptanehydrazide.
| Compound Name | (2R)-2-[3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]phenyl]-7-(2-hydroxyethylsulfonyl)-N',2,6,6-tetramethyl-N'-phenacylheptanehydrazide |
|---|---|
| PubChem CID | 176798626 |
| Molecular Formula | C32H46N2O7S |
| Molecular Weight | 602.79 g/mol |
| Exact Mass | 602.30 |
| IUPAC Name | (2R)-2-[3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]phenyl]-7-(2-hydroxyethylsulfonyl)-N',2,6,6-tetramethyl-N'-phenacylheptanehydrazide |
| SMILES | CN(CC(=O)c1ccccc1)NC(=O)[C@](C)(CCCC(C)(C)CS(=O)(=O)CCO)c1cccc([C@@H]2COC(C)(C)O2)c1 |
| InChI | InChI=1S/C32H46N2O7S/c1-30(2,23-42(38,39)19-18-35)16-11-17-32(5,26-15-10-14-25(20-26)28-22-40-31(3,4)41-28)29(37)33-34(6)21-27(36)24-12-8-7-9-13-24/h7-10,12-15,20,28,35H,11,16-19,21-23H2,1-6H3,(H,33,37)/t28-,32+/m0/s1 |
| InChIKey | NEEZXUFEJTXMLX-GMCHKSTQSA-N |
| XLogP | 4.22 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.79 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|