About CID 176800351
CID 176800351 (PubChem CID 176800351) has the molecular formula C30H46O11
and a molecular weight of 582.69 g/mol.
Molecular Properties
| Compound Name | CID 176800351 |
| PubChem CID | 176800351 |
| Molecular Formula | C30H46O11 |
| Molecular Weight | 582.69 g/mol |
| Exact Mass | 582.30 |
| IUPAC Name | — |
| SMILES | OC1[C@@H]2OC3(CCCCC3)COC2O[C@H](O[C@H]2OC3COC4(CCCCC4)O[C@H]3[C@@H]3OC4(CCCCC4)OC23)[C@@H]1O |
| InChI | InChI=1S/C30H46O11/c31-19-20(32)25(36-26-22(19)38-28(17-33-26)10-4-1-5-11-28)37-27-24-23(40-30(41-24)14-8-3-9-15-30)21-18(35-27)16-34-29(39-21)12-6-2-7-13-29/h18-27,31-32H,1-17H2/t18?,19?,20-,21-,22+,23+,24?,25-,26?,27-/m1/s1 |
| InChIKey | CKKTXVKHMWELHM-XBKSQDIYSA-N |
| XLogP | 2.77 |
| TPSA | 123.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 582.69 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
Analyze CID 176800351 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176800351?
The IUPAC name of CID 176800351 (CID 176800351) is not available.
What is the SMILES notation for CID 176800351?
The canonical SMILES for CID 176800351 is OC1[C@@H]2OC3(CCCCC3)COC2O[C@H](O[C@H]2OC3COC4(CCCCC4)O[C@H]3[C@@H]3OC4(CCCCC4)OC23)[C@@H]1O.
What is the InChIKey of CID 176800351?
The InChIKey is CKKTXVKHMWELHM-XBKSQDIYSA-N. The full InChI is InChI=1S/C30H46O11/c31-19-20(32)25(36-26-22(19)38-28(17-33-26)10-4-1-5-11-28)37-27-24-23(40-30(41-24)14-8-3-9-15-30)21-18(35-27)16-34-29(39-21)12-6-2-7-13-29/h18-27,31-32H,1-17H2/t18?,19?,20-,21-,22+,23+,24?,25-,26?,27-/m1/s1.
What are the key properties of CID 176800351?
CID 176800351 has a molecular weight of 582.69 g/mol, XLogP of 2.77, 2 rotatable bonds, 2 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176800351 is sourced from PubChem (CID 176800351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).