About 4-chloro-5-(1,3-dioxolan-2-yl)-2-fluoroaniline
4-chloro-5-(1,3-dioxolan-2-yl)-2-fluoroaniline (PubChem CID 176800630) has the molecular formula C9H9ClFNO2
and a molecular weight of 217.63 g/mol. Its IUPAC name is 4-chloro-5-(1,3-dioxolan-2-yl)-2-fluoroaniline.
Molecular Properties
| Compound Name | 4-chloro-5-(1,3-dioxolan-2-yl)-2-fluoroaniline |
| PubChem CID | 176800630 |
| Molecular Formula | C9H9ClFNO2 |
| Molecular Weight | 217.63 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | 4-chloro-5-(1,3-dioxolan-2-yl)-2-fluoroaniline |
| SMILES | Nc1cc(C2OCCO2)c(Cl)cc1F |
| InChI | InChI=1S/C9H9ClFNO2/c10-6-4-7(11)8(12)3-5(6)9-13-1-2-14-9/h3-4,9H,1-2,12H2 |
| InChIKey | WTWHNVAWUZMYLF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.63 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-5-(1,3-dioxolan-2-yl)-2-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-(1,3-dioxolan-2-yl)-2-fluoroaniline?
The IUPAC name of 4-chloro-5-(1,3-dioxolan-2-yl)-2-fluoroaniline (CID 176800630) is 4-chloro-5-(1,3-dioxolan-2-yl)-2-fluoroaniline.
What is the SMILES notation for 4-chloro-5-(1,3-dioxolan-2-yl)-2-fluoroaniline?
The canonical SMILES for 4-chloro-5-(1,3-dioxolan-2-yl)-2-fluoroaniline is Nc1cc(C2OCCO2)c(Cl)cc1F.
What is the InChIKey of 4-chloro-5-(1,3-dioxolan-2-yl)-2-fluoroaniline?
The InChIKey is WTWHNVAWUZMYLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClFNO2/c10-6-4-7(11)8(12)3-5(6)9-13-1-2-14-9/h3-4,9H,1-2,12H2.
What are the key properties of 4-chloro-5-(1,3-dioxolan-2-yl)-2-fluoroaniline?
4-chloro-5-(1,3-dioxolan-2-yl)-2-fluoroaniline has a molecular weight of 217.63 g/mol, XLogP of 2.11, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-(1,3-dioxolan-2-yl)-2-fluoroaniline is sourced from PubChem (CID 176800630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).