About 6-tert-butyl-11-oxa-2-azatricyclo[6.2.1.02,6]undecane
6-tert-butyl-11-oxa-2-azatricyclo[6.2.1.02,6]undecane (PubChem CID 176800715) has the molecular formula C13H23NO
and a molecular weight of 209.33 g/mol. Its IUPAC name is 6-tert-butyl-11-oxa-2-azatricyclo[6.2.1.02,6]undecane.
Molecular Properties
| Compound Name | 6-tert-butyl-11-oxa-2-azatricyclo[6.2.1.02,6]undecane |
| PubChem CID | 176800715 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 6-tert-butyl-11-oxa-2-azatricyclo[6.2.1.02,6]undecane |
| SMILES | CC(C)(C)C12CCCN1C1CCC(C2)O1 |
| InChI | InChI=1S/C13H23NO/c1-12(2,3)13-7-4-8-14(13)11-6-5-10(9-13)15-11/h10-11H,4-9H2,1-3H3 |
| InChIKey | JHYRICPBGOSAHS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-tert-butyl-11-oxa-2-azatricyclo[6.2.1.02,6]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-11-oxa-2-azatricyclo[6.2.1.02,6]undecane?
The IUPAC name of 6-tert-butyl-11-oxa-2-azatricyclo[6.2.1.02,6]undecane (CID 176800715) is 6-tert-butyl-11-oxa-2-azatricyclo[6.2.1.02,6]undecane.
What is the SMILES notation for 6-tert-butyl-11-oxa-2-azatricyclo[6.2.1.02,6]undecane?
The canonical SMILES for 6-tert-butyl-11-oxa-2-azatricyclo[6.2.1.02,6]undecane is CC(C)(C)C12CCCN1C1CCC(C2)O1.
What is the InChIKey of 6-tert-butyl-11-oxa-2-azatricyclo[6.2.1.02,6]undecane?
The InChIKey is JHYRICPBGOSAHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO/c1-12(2,3)13-7-4-8-14(13)11-6-5-10(9-13)15-11/h10-11H,4-9H2,1-3H3.
What are the key properties of 6-tert-butyl-11-oxa-2-azatricyclo[6.2.1.02,6]undecane?
6-tert-butyl-11-oxa-2-azatricyclo[6.2.1.02,6]undecane has a molecular weight of 209.33 g/mol, XLogP of 2.78, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-11-oxa-2-azatricyclo[6.2.1.02,6]undecane is sourced from PubChem (CID 176800715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).