C13H20F3N — CID 176800788
8-tert-butyl-1',1',2-trifluorospiro[2,3,5,7-tetrahydro-1H-pyrrolizine-6,2'-cyclopropane] (PubChem CID 176800788) has the molecular formula C13H20F3N and a molecular weight of 247.30 g/mol. Its IUPAC name is 8-tert-butyl-1',1',2-trifluorospiro[2,3,5,7-tetrahydro-1H-pyrrolizine-6,2'-cyclopropane].
| Compound Name | 8-tert-butyl-1',1',2-trifluorospiro[2,3,5,7-tetrahydro-1H-pyrrolizine-6,2'-cyclopropane] |
|---|---|
| PubChem CID | 176800788 |
| Molecular Formula | C13H20F3N |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | 8-tert-butyl-1',1',2-trifluorospiro[2,3,5,7-tetrahydro-1H-pyrrolizine-6,2'-cyclopropane] |
| SMILES | CC(C)(C)C12CC(F)CN1CC1(CC1(F)F)C2 |
| InChI | InChI=1S/C13H20F3N/c1-10(2,3)12-4-9(14)5-17(12)8-11(6-12)7-13(11,15)16/h9H,4-8H2,1-3H3 |
| InChIKey | GQWRTAVJXCNNCI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |