C15H25F2NO — CID 176800852
8-tert-butyl-3-[(2,2-difluorocyclopropyl)oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 176800852) has the molecular formula C15H25F2NO and a molecular weight of 273.37 g/mol. Its IUPAC name is 8-tert-butyl-3-[(2,2-difluorocyclopropyl)oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | 8-tert-butyl-3-[(2,2-difluorocyclopropyl)oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 176800852 |
| Molecular Formula | C15H25F2NO |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | 8-tert-butyl-3-[(2,2-difluorocyclopropyl)oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | CC(C)(C)C12CCCN1C(COC1CC1(F)F)CC2 |
| InChI | InChI=1S/C15H25F2NO/c1-13(2,3)14-6-4-8-18(14)11(5-7-14)10-19-12-9-15(12,16)17/h11-12H,4-10H2,1-3H3 |
| InChIKey | UUWBUDYXMPJUOU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |