C21H24N6O2 — CID 176801067
5-(4-methoxyphenyl)-3-[[2-(4-methylpiperazin-1-yl)pyrimidin-4-yl]amino]-1H-pyridin-2-one (PubChem CID 176801067) has the molecular formula C21H24N6O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-3-[[2-(4-methylpiperazin-1-yl)pyrimidin-4-yl]amino]-1H-pyridin-2-one.
| Compound Name | 5-(4-methoxyphenyl)-3-[[2-(4-methylpiperazin-1-yl)pyrimidin-4-yl]amino]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 176801067 |
| Molecular Formula | C21H24N6O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 5-(4-methoxyphenyl)-3-[[2-(4-methylpiperazin-1-yl)pyrimidin-4-yl]amino]-1H-pyridin-2-one |
| SMILES | COc1ccc(-c2c[nH]c(=O)c(Nc3ccnc(N4CCN(C)CC4)n3)c2)cc1 |
| InChI | InChI=1S/C21H24N6O2/c1-26-9-11-27(12-10-26)21-22-8-7-19(25-21)24-18-13-16(14-23-20(18)28)15-3-5-17(29-2)6-4-15/h3-8,13-14H,9-12H2,1-2H3,(H,23,28)(H,22,24,25) |
| InChIKey | PDZLKHJDPBQZQD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |