C15H18FNO2 — CID 176801174
methyl (3R,8S)-3-(4-fluorophenyl)-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate (PubChem CID 176801174) has the molecular formula C15H18FNO2 and a molecular weight of 263.31 g/mol. Its IUPAC name is methyl (3R,8S)-3-(4-fluorophenyl)-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate.
| Compound Name | methyl (3R,8S)-3-(4-fluorophenyl)-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate |
|---|---|
| PubChem CID | 176801174 |
| Molecular Formula | C15H18FNO2 |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | methyl (3R,8S)-3-(4-fluorophenyl)-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate |
| SMILES | COC(=O)[C@@]12CCCN1[C@@H](c1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C15H18FNO2/c1-19-14(18)15-8-2-10-17(15)13(7-9-15)11-3-5-12(16)6-4-11/h3-6,13H,2,7-10H2,1H3/t13-,15+/m1/s1 |
| InChIKey | WKZDIAZRULWDHF-HIFRSBDPSA-N |
| XLogP | 2.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |