C38H46FN6O4P — CID 176801186
tert-butyl 3-[7-(3-dimethylphosphorylnaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 176801186) has the molecular formula C38H46FN6O4P and a molecular weight of 700.80 g/mol. Its IUPAC name is tert-butyl 3-[7-(3-dimethylphosphorylnaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-[7-(3-dimethylphosphorylnaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 176801186 |
| Molecular Formula | C38H46FN6O4P |
| Molecular Weight | 700.80 g/mol |
| Exact Mass | 700.33 |
| IUPAC Name | tert-butyl 3-[7-(3-dimethylphosphorylnaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CN(c1nc(OCC34CCCN3CCC4)nc3c(F)c(-c4cc(P(C)(C)=O)cc5ccccc45)ncc13)C2 |
| InChI | InChI=1S/C38H46FN6O4P/c1-37(2,3)49-36(46)45-25-12-13-26(45)22-43(21-25)34-30-20-40-32(29-19-27(50(4,5)47)18-24-10-6-7-11-28(24)29)31(39)33(30)41-35(42-34)48-23-38-14-8-16-44(38)17-9-15-38/h6-7,10-11,18-20,25-26H,8-9,12-17,21-23H2,1-5H3 |
| InChIKey | YQWXRQMXDHOGNC-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 100.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.80 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|