C10H11N5O4 — CID 176801448
[(2R,4R,5S)-4-(6-aminopurin-9-yl)-3,6,7-trioxabicyclo[3.2.0]heptan-2-yl]methanol (PubChem CID 176801448) has the molecular formula C10H11N5O4 and a molecular weight of 265.23 g/mol. Its IUPAC name is [(2R,4R,5S)-4-(6-aminopurin-9-yl)-3,6,7-trioxabicyclo[3.2.0]heptan-2-yl]methanol.
| Compound Name | [(2R,4R,5S)-4-(6-aminopurin-9-yl)-3,6,7-trioxabicyclo[3.2.0]heptan-2-yl]methanol |
|---|---|
| PubChem CID | 176801448 |
| Molecular Formula | C10H11N5O4 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | [(2R,4R,5S)-4-(6-aminopurin-9-yl)-3,6,7-trioxabicyclo[3.2.0]heptan-2-yl]methanol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)C2OO[C@@H]21 |
| InChI | InChI=1S/C10H11N5O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7-6(18-19-7)4(1-16)17-10/h2-4,6-7,10,16H,1H2,(H2,11,12,13)/t4-,6?,7+,10-/m1/s1 |
| InChIKey | BPUSYOCZMJWDMZ-HMEJCUHCSA-N |
| XLogP | -1.00 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|