C15H20N2O4 — CID 176801950
[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]-(3-phenyloxaziridin-2-yl)methanone (PubChem CID 176801950) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is [(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]-(3-phenyloxaziridin-2-yl)methanone.
| Compound Name | [(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]-(3-phenyloxaziridin-2-yl)methanone |
|---|---|
| PubChem CID | 176801950 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | [(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]-(3-phenyloxaziridin-2-yl)methanone |
| SMILES | COC[C@@H]1C[C@H](OC)CN1C(=O)N1OC1c1ccccc1 |
| InChI | InChI=1S/C15H20N2O4/c1-19-10-12-8-13(20-2)9-16(12)15(18)17-14(21-17)11-6-4-3-5-7-11/h3-7,12-14H,8-10H2,1-2H3/t12-,13-,14?,17?/m0/s1 |
| InChIKey | YUKVEIBTPUDKPQ-YRFCHQJDSA-N |
| XLogP | 1.79 |
| TPSA | 54.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|