C19H24O10 — CID 176803256
[(4S,7S,8R,11S)-2-oxo-8-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-oxatricyclo[5.3.1.04,11]undeca-1(10),5-dien-6-yl]methyl acetate (PubChem CID 176803256) has the molecular formula C19H24O10 and a molecular weight of 412.39 g/mol. Its IUPAC name is [(4S,7S,8R,11S)-2-oxo-8-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-oxatricyclo[5.3.1.04,11]undeca-1(10),5-dien-6-yl]methyl acetate.
| Compound Name | [(4S,7S,8R,11S)-2-oxo-8-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-oxatricyclo[5.3.1.04,11]undeca-1(10),5-dien-6-yl]methyl acetate |
|---|---|
| PubChem CID | 176803256 |
| Molecular Formula | C19H24O10 |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | [(4S,7S,8R,11S)-2-oxo-8-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-oxatricyclo[5.3.1.04,11]undeca-1(10),5-dien-6-yl]methyl acetate |
| SMILES | CC(=O)OCC1=C[C@@H]2OC(=O)C3=CC[C@@H](O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)[C@H]1[C@@H]32 |
| InChI | InChI=1S/C19H24O10/c1-7(21)26-6-8-4-11-14-9(18(25)27-11)2-3-10(13(8)14)28-19-17(24)16(23)15(22)12(5-20)29-19/h2,4,10-17,19-20,22-24H,3,5-6H2,1H3/t10-,11+,12-,13+,14+,15-,16+,17-,19-/m1/s1 |
| InChIKey | RWKBJXCDKMFKSD-BFJCGFGKSA-N |
| XLogP | -1.84 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|