About 2,4,5-trimethyl-6H-thieno[2,3-b]pyrrole
2,4,5-trimethyl-6H-thieno[2,3-b]pyrrole (PubChem CID 176804488) has the molecular formula C9H11NS
and a molecular weight of 165.26 g/mol. Its IUPAC name is 2,4,5-trimethyl-6H-thieno[2,3-b]pyrrole.
Molecular Properties
| Compound Name | 2,4,5-trimethyl-6H-thieno[2,3-b]pyrrole |
| PubChem CID | 176804488 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 2,4,5-trimethyl-6H-thieno[2,3-b]pyrrole |
| SMILES | Cc1cc2c(C)c(C)[nH]c2s1 |
| InChI | InChI=1S/C9H11NS/c1-5-4-8-6(2)7(3)10-9(8)11-5/h4,10H,1-3H3 |
| InChIKey | AGXPRSCXNNKWFY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4,5-trimethyl-6H-thieno[2,3-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,5-trimethyl-6H-thieno[2,3-b]pyrrole?
The IUPAC name of 2,4,5-trimethyl-6H-thieno[2,3-b]pyrrole (CID 176804488) is 2,4,5-trimethyl-6H-thieno[2,3-b]pyrrole.
What is the SMILES notation for 2,4,5-trimethyl-6H-thieno[2,3-b]pyrrole?
The canonical SMILES for 2,4,5-trimethyl-6H-thieno[2,3-b]pyrrole is Cc1cc2c(C)c(C)[nH]c2s1.
What is the InChIKey of 2,4,5-trimethyl-6H-thieno[2,3-b]pyrrole?
The InChIKey is AGXPRSCXNNKWFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NS/c1-5-4-8-6(2)7(3)10-9(8)11-5/h4,10H,1-3H3.
What are the key properties of 2,4,5-trimethyl-6H-thieno[2,3-b]pyrrole?
2,4,5-trimethyl-6H-thieno[2,3-b]pyrrole has a molecular weight of 165.26 g/mol, XLogP of 3.15, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,5-trimethyl-6H-thieno[2,3-b]pyrrole is sourced from PubChem (CID 176804488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).